C13H19N3O7 — CID 68993020
tert-butyl N-[2-[[2-(1-hydroxy-2,5-dioxopyrrolidin-3-yl)-2-oxoethyl]amino]-2-oxoethyl]carbamate (PubChem CID 68993020) has the molecular formula C13H19N3O7 and a molecular weight of 329.31 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-(1-hydroxy-2,5-dioxopyrrolidin-3-yl)-2-oxoethyl]amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-(1-hydroxy-2,5-dioxopyrrolidin-3-yl)-2-oxoethyl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 68993020 |
| Molecular Formula | C13H19N3O7 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | tert-butyl N-[2-[[2-(1-hydroxy-2,5-dioxopyrrolidin-3-yl)-2-oxoethyl]amino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NCC(=O)C1CC(=O)N(O)C1=O |
| InChI | InChI=1S/C13H19N3O7/c1-13(2,3)23-12(21)15-6-9(18)14-5-8(17)7-4-10(19)16(22)11(7)20/h7,22H,4-6H2,1-3H3,(H,14,18)(H,15,21) |
| InChIKey | RUWWJXCRNQSHDG-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|