C17H19ClN2S — CID 46199073
3-(2-chloro-1,3,4,6,7,8,9-heptadeuteriophenothiazin-10-yl)-1,1,2,2,3,3-hexadeuterio-N,N-bis(trideuteriomethyl)propan-1-amine (PubChem CID 46199073) has the molecular formula C17H19ClN2S and a molecular weight of 337.99 g/mol. Its IUPAC name is 3-(2-chloro-1,3,4,6,7,8,9-heptadeuteriophenothiazin-10-yl)-1,1,2,2,3,3-hexadeuterio-N,N-bis(trideuteriomethyl)propan-1-amine.
| Compound Name | 3-(2-chloro-1,3,4,6,7,8,9-heptadeuteriophenothiazin-10-yl)-1,1,2,2,3,3-hexadeuterio-N,N-bis(trideuteriomethyl)propan-1-amine |
|---|---|
| PubChem CID | 46199073 |
| Molecular Formula | C17H19ClN2S |
| Molecular Weight | 337.99 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | 3-(2-chloro-1,3,4,6,7,8,9-heptadeuteriophenothiazin-10-yl)-1,1,2,2,3,3-hexadeuterio-N,N-bis(trideuteriomethyl)propan-1-amine |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])Sc1c([2H])c([2H])c(Cl)c([2H])c1N2C([2H])([2H])C([2H])([2H])C([2H])([2H])N(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C17H19ClN2S/c1-19(2)10-5-11-20-14-6-3-4-7-16(14)21-17-9-8-13(18)12-15(17)20/h3-4,6-9,12H,5,10-11H2,1-2H3/i1D3,2D3,3D,4D,5D2,6D,7D,8D,9D,10D2,11D2,12D |
| InChIKey | ZPEIMTDSQAKGNT-DSXKFZJISA-N |
| XLogP | 4.89 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.99 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |