C25H21FN6O2 — CID 46200134
4-(4-fluorophenyl)-1-[(E)-2-[7-(4-methylimidazol-1-yl)-1,2-benzoxazol-4-yl]ethenyl]-4,6,7,8-tetrahydropyrazolo[1,2-a][1,2,4]triazin-3-one (PubChem CID 46200134) has the molecular formula C25H21FN6O2 and a molecular weight of 456.48 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-1-[(E)-2-[7-(4-methylimidazol-1-yl)-1,2-benzoxazol-4-yl]ethenyl]-4,6,7,8-tetrahydropyrazolo[1,2-a][1,2,4]triazin-3-one.
| Compound Name | 4-(4-fluorophenyl)-1-[(E)-2-[7-(4-methylimidazol-1-yl)-1,2-benzoxazol-4-yl]ethenyl]-4,6,7,8-tetrahydropyrazolo[1,2-a][1,2,4]triazin-3-one |
|---|---|
| PubChem CID | 46200134 |
| Molecular Formula | C25H21FN6O2 |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 4-(4-fluorophenyl)-1-[(E)-2-[7-(4-methylimidazol-1-yl)-1,2-benzoxazol-4-yl]ethenyl]-4,6,7,8-tetrahydropyrazolo[1,2-a][1,2,4]triazin-3-one |
| SMILES | Cc1cn(-c2ccc(/C=C/C3=NC(=O)C(c4ccc(F)cc4)N4CCCN34)c3cnoc23)cn1 |
| InChI | InChI=1S/C25H21FN6O2/c1-16-14-30(15-27-16)21-9-5-17(20-13-28-34-24(20)21)6-10-22-29-25(33)23(32-12-2-11-31(22)32)18-3-7-19(26)8-4-18/h3-10,13-15,23H,2,11-12H2,1H3/b10-6+ |
| InChIKey | RGLMCVPEAPDLPL-UXBLZVDNSA-N |
| XLogP | 4.08 |
| TPSA | 79.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |