C19H14N2O3 — CID 46222399
10-(4-nitrophenyl)-6,11-dihydrobenzo[c][1,5]benzoxazepine (PubChem CID 46222399) has the molecular formula C19H14N2O3 and a molecular weight of 318.33 g/mol. Its IUPAC name is 10-(4-nitrophenyl)-6,11-dihydrobenzo[c][1,5]benzoxazepine.
| Compound Name | 10-(4-nitrophenyl)-6,11-dihydrobenzo[c][1,5]benzoxazepine |
|---|---|
| PubChem CID | 46222399 |
| Molecular Formula | C19H14N2O3 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 10-(4-nitrophenyl)-6,11-dihydrobenzo[c][1,5]benzoxazepine |
| SMILES | O=[N+]([O-])c1ccc(-c2cccc3c2Nc2ccccc2OC3)cc1 |
| InChI | InChI=1S/C19H14N2O3/c22-21(23)15-10-8-13(9-11-15)16-5-3-4-14-12-24-18-7-2-1-6-17(18)20-19(14)16/h1-11,20H,12H2 |
| InChIKey | BEHDRDYJAFRQRD-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|