C23H33ClN6O2 — CID 46227175
2-[4-[2-[(7-chloroquinolin-4-yl)amino]ethyl]piperazin-1-yl]-N-[2-(diethylamino)ethyl]-2-oxoacetamide (PubChem CID 46227175) has the molecular formula C23H33ClN6O2 and a molecular weight of 461.01 g/mol. Its IUPAC name is 2-[4-[2-[(7-chloroquinolin-4-yl)amino]ethyl]piperazin-1-yl]-N-[2-(diethylamino)ethyl]-2-oxoacetamide.
| Compound Name | 2-[4-[2-[(7-chloroquinolin-4-yl)amino]ethyl]piperazin-1-yl]-N-[2-(diethylamino)ethyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 46227175 |
| Molecular Formula | C23H33ClN6O2 |
| Molecular Weight | 461.01 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | 2-[4-[2-[(7-chloroquinolin-4-yl)amino]ethyl]piperazin-1-yl]-N-[2-(diethylamino)ethyl]-2-oxoacetamide |
| SMILES | CCN(CC)CCNC(=O)C(=O)N1CCN(CCNc2ccnc3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C23H33ClN6O2/c1-3-28(4-2)11-10-27-22(31)23(32)30-15-13-29(14-16-30)12-9-26-20-7-8-25-21-17-18(24)5-6-19(20)21/h5-8,17H,3-4,9-16H2,1-2H3,(H,25,26)(H,27,31) |
| InChIKey | HSGYRVYOYVOYMT-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 80.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.01 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|