C17H16FN3O3 — CID 46237182
5-(3-fluorophenyl)-1-(3,4,5-trimethoxyphenyl)-1,2,4-triazole (PubChem CID 46237182) has the molecular formula C17H16FN3O3 and a molecular weight of 329.33 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-1-(3,4,5-trimethoxyphenyl)-1,2,4-triazole.
| Compound Name | 5-(3-fluorophenyl)-1-(3,4,5-trimethoxyphenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 46237182 |
| Molecular Formula | C17H16FN3O3 |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 5-(3-fluorophenyl)-1-(3,4,5-trimethoxyphenyl)-1,2,4-triazole |
| SMILES | COc1cc(-n2ncnc2-c2cccc(F)c2)cc(OC)c1OC |
| InChI | InChI=1S/C17H16FN3O3/c1-22-14-8-13(9-15(23-2)16(14)24-3)21-17(19-10-20-21)11-5-4-6-12(18)7-11/h4-10H,1-3H3 |
| InChIKey | UVFAULBDLYLDQM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |