C19H19FN4O3 — CID 66912561
3-(3-fluorophenyl)-6-N-(3,4,5-trimethoxyphenyl)pyrazine-2,6-diamine (PubChem CID 66912561) has the molecular formula C19H19FN4O3 and a molecular weight of 370.38 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-6-N-(3,4,5-trimethoxyphenyl)pyrazine-2,6-diamine.
| Compound Name | 3-(3-fluorophenyl)-6-N-(3,4,5-trimethoxyphenyl)pyrazine-2,6-diamine |
|---|---|
| PubChem CID | 66912561 |
| Molecular Formula | C19H19FN4O3 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 3-(3-fluorophenyl)-6-N-(3,4,5-trimethoxyphenyl)pyrazine-2,6-diamine |
| SMILES | COc1cc(Nc2cnc(-c3cccc(F)c3)c(N)n2)cc(OC)c1OC |
| InChI | InChI=1S/C19H19FN4O3/c1-25-14-8-13(9-15(26-2)18(14)27-3)23-16-10-22-17(19(21)24-16)11-5-4-6-12(20)7-11/h4-10H,1-3H3,(H3,21,23,24) |
| InChIKey | VLJZJUQWCJWTML-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |