C32H42Cl2N3O5P — CID 46245165
1-(2,4-dichlorophenyl)-N-[2-(3-diethoxyphosphorylpropoxymethyl)cyclohexyl]-4-methyl-5-(4-methylphenyl)pyrazole-3-carboxamide (PubChem CID 46245165) has the molecular formula C32H42Cl2N3O5P and a molecular weight of 650.58 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-N-[2-(3-diethoxyphosphorylpropoxymethyl)cyclohexyl]-4-methyl-5-(4-methylphenyl)pyrazole-3-carboxamide.
| Compound Name | 1-(2,4-dichlorophenyl)-N-[2-(3-diethoxyphosphorylpropoxymethyl)cyclohexyl]-4-methyl-5-(4-methylphenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 46245165 |
| Molecular Formula | C32H42Cl2N3O5P |
| Molecular Weight | 650.58 g/mol |
| Exact Mass | 649.22 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-N-[2-(3-diethoxyphosphorylpropoxymethyl)cyclohexyl]-4-methyl-5-(4-methylphenyl)pyrazole-3-carboxamide |
| SMILES | CCOP(=O)(CCCOCC1CCCCC1NC(=O)c1nn(-c2ccc(Cl)cc2Cl)c(-c2ccc(C)cc2)c1C)OCC |
| InChI | InChI=1S/C32H42Cl2N3O5P/c1-5-41-43(39,42-6-2)19-9-18-40-21-25-10-7-8-11-28(25)35-32(38)30-23(4)31(24-14-12-22(3)13-15-24)37(36-30)29-17-16-26(33)20-27(29)34/h12-17,20,25,28H,5-11,18-19,21H2,1-4H3,(H,35,38) |
| InChIKey | VFIDLSHTDIZMBC-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.58 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|