C24H21Cl2N5OS — CID 46253386
N-(3-chlorophenyl)-4-[2-(4-chlorophenyl)-7-oxo-1H-pyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carbothioamide (PubChem CID 46253386) has the molecular formula C24H21Cl2N5OS and a molecular weight of 498.44 g/mol. Its IUPAC name is N-(3-chlorophenyl)-4-[2-(4-chlorophenyl)-7-oxo-1H-pyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carbothioamide.
| Compound Name | N-(3-chlorophenyl)-4-[2-(4-chlorophenyl)-7-oxo-1H-pyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 46253386 |
| Molecular Formula | C24H21Cl2N5OS |
| Molecular Weight | 498.44 g/mol |
| Exact Mass | 497.08 |
| IUPAC Name | N-(3-chlorophenyl)-4-[2-(4-chlorophenyl)-7-oxo-1H-pyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carbothioamide |
| SMILES | O=c1cc(C2CCN(C(=S)Nc3cccc(Cl)c3)CC2)nc2cc(-c3ccc(Cl)cc3)[nH]n12 |
| InChI | InChI=1S/C24H21Cl2N5OS/c25-17-6-4-15(5-7-17)21-13-22-28-20(14-23(32)31(22)29-21)16-8-10-30(11-9-16)24(33)27-19-3-1-2-18(26)12-19/h1-7,12-14,16,29H,8-11H2,(H,27,33) |
| InChIKey | AIRSYXLPBKZOIP-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.44 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|