C23H16F3N5O2S — CID 46383087
2-[10-(4-methylphenyl)-5-oxo-12-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,10-tetraen-4-yl]-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 46383087) has the molecular formula C23H16F3N5O2S and a molecular weight of 483.48 g/mol. Its IUPAC name is 2-[10-(4-methylphenyl)-5-oxo-12-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,10-tetraen-4-yl]-N-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[10-(4-methylphenyl)-5-oxo-12-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,10-tetraen-4-yl]-N-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 46383087 |
| Molecular Formula | C23H16F3N5O2S |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | 2-[10-(4-methylphenyl)-5-oxo-12-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,10-tetraen-4-yl]-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cc1ccc(-c2csc3c2ncn2c(=O)n(CC(=O)Nc4ccc(C(F)(F)F)cc4)nc32)cc1 |
| InChI | InChI=1S/C23H16F3N5O2S/c1-13-2-4-14(5-3-13)17-11-34-20-19(17)27-12-30-21(20)29-31(22(30)33)10-18(32)28-16-8-6-15(7-9-16)23(24,25)26/h2-9,11-12H,10H2,1H3,(H,28,32) |
| InChIKey | MFHVWRNRBLBRBO-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |