C23H18ClN5O3S — CID 50826408
N-(3-chloro-4-methoxyphenyl)-2-[10-(4-methylphenyl)-5-oxo-12-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,10-tetraen-4-yl]acetamide (PubChem CID 50826408) has the molecular formula C23H18ClN5O3S and a molecular weight of 479.95 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-2-[10-(4-methylphenyl)-5-oxo-12-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,10-tetraen-4-yl]acetamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-2-[10-(4-methylphenyl)-5-oxo-12-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,10-tetraen-4-yl]acetamide |
|---|---|
| PubChem CID | 50826408 |
| Molecular Formula | C23H18ClN5O3S |
| Molecular Weight | 479.95 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-2-[10-(4-methylphenyl)-5-oxo-12-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,10-tetraen-4-yl]acetamide |
| SMILES | COc1ccc(NC(=O)Cn2nc3c4scc(-c5ccc(C)cc5)c4ncn3c2=O)cc1Cl |
| InChI | InChI=1S/C23H18ClN5O3S/c1-13-3-5-14(6-4-13)16-11-33-21-20(16)25-12-28-22(21)27-29(23(28)31)10-19(30)26-15-7-8-18(32-2)17(24)9-15/h3-9,11-12H,10H2,1-2H3,(H,26,30) |
| InChIKey | LVSSZWNUUFOECK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.95 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |