C22H15F2N5O3S — CID 50826178
N-(3,4-difluorophenyl)-2-[10-(4-methoxyphenyl)-5-oxo-12-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,10-tetraen-4-yl]acetamide (PubChem CID 50826178) has the molecular formula C22H15F2N5O3S and a molecular weight of 467.46 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-[10-(4-methoxyphenyl)-5-oxo-12-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,10-tetraen-4-yl]acetamide.
| Compound Name | N-(3,4-difluorophenyl)-2-[10-(4-methoxyphenyl)-5-oxo-12-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,10-tetraen-4-yl]acetamide |
|---|---|
| PubChem CID | 50826178 |
| Molecular Formula | C22H15F2N5O3S |
| Molecular Weight | 467.46 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-[10-(4-methoxyphenyl)-5-oxo-12-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,10-tetraen-4-yl]acetamide |
| SMILES | COc1ccc(-c2csc3c2ncn2c(=O)n(CC(=O)Nc4ccc(F)c(F)c4)nc32)cc1 |
| InChI | InChI=1S/C22H15F2N5O3S/c1-32-14-5-2-12(3-6-14)15-10-33-20-19(15)25-11-28-21(20)27-29(22(28)31)9-18(30)26-13-4-7-16(23)17(24)8-13/h2-8,10-11H,9H2,1H3,(H,26,30) |
| InChIKey | YUPJOXJUXAHVHN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |