C24H18FN5O4S — CID 50826291
ethyl 4-[[2-[10-(4-fluorophenyl)-5-oxo-12-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,10-tetraen-4-yl]acetyl]amino]benzoate (PubChem CID 50826291) has the molecular formula C24H18FN5O4S and a molecular weight of 491.50 g/mol. Its IUPAC name is ethyl 4-[[2-[10-(4-fluorophenyl)-5-oxo-12-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,10-tetraen-4-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[10-(4-fluorophenyl)-5-oxo-12-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,10-tetraen-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 50826291 |
| Molecular Formula | C24H18FN5O4S |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | ethyl 4-[[2-[10-(4-fluorophenyl)-5-oxo-12-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,10-tetraen-4-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Cn2nc3c4scc(-c5ccc(F)cc5)c4ncn3c2=O)cc1 |
| InChI | InChI=1S/C24H18FN5O4S/c1-2-34-23(32)15-5-9-17(10-6-15)27-19(31)11-30-24(33)29-13-26-20-18(12-35-21(20)22(29)28-30)14-3-7-16(25)8-4-14/h3-10,12-13H,2,11H2,1H3,(H,27,31) |
| InChIKey | HELBWOLIIBOFTK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 107.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |