C22H16FN5O3S — CID 50826394
2-[10-(4-fluorophenyl)-5-oxo-12-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,10-tetraen-4-yl]-N-(2-methoxyphenyl)acetamide (PubChem CID 50826394) has the molecular formula C22H16FN5O3S and a molecular weight of 449.47 g/mol. Its IUPAC name is 2-[10-(4-fluorophenyl)-5-oxo-12-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,10-tetraen-4-yl]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[10-(4-fluorophenyl)-5-oxo-12-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,10-tetraen-4-yl]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 50826394 |
| Molecular Formula | C22H16FN5O3S |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | 2-[10-(4-fluorophenyl)-5-oxo-12-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,10-tetraen-4-yl]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)Cn1nc2c3scc(-c4ccc(F)cc4)c3ncn2c1=O |
| InChI | InChI=1S/C22H16FN5O3S/c1-31-17-5-3-2-4-16(17)25-18(29)10-28-22(30)27-12-24-19-15(11-32-20(19)21(27)26-28)13-6-8-14(23)9-7-13/h2-9,11-12H,10H2,1H3,(H,25,29) |
| InChIKey | ULEIEDLTKUKARF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |