C24H19N5O4S — CID 50826216
methyl 2-[[2-[10-(4-methylphenyl)-5-oxo-12-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,10-tetraen-4-yl]acetyl]amino]benzoate (PubChem CID 50826216) has the molecular formula C24H19N5O4S and a molecular weight of 473.51 g/mol. Its IUPAC name is methyl 2-[[2-[10-(4-methylphenyl)-5-oxo-12-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,10-tetraen-4-yl]acetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[10-(4-methylphenyl)-5-oxo-12-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,10-tetraen-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 50826216 |
| Molecular Formula | C24H19N5O4S |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | methyl 2-[[2-[10-(4-methylphenyl)-5-oxo-12-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,10-tetraen-4-yl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)Cn1nc2c3scc(-c4ccc(C)cc4)c3ncn2c1=O |
| InChI | InChI=1S/C24H19N5O4S/c1-14-7-9-15(10-8-14)17-12-34-21-20(17)25-13-28-22(21)27-29(24(28)32)11-19(30)26-18-6-4-3-5-16(18)23(31)33-2/h3-10,12-13H,11H2,1-2H3,(H,26,30) |
| InChIKey | VNUSBOSLIWENBO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 107.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |