C25H18BrN3O2S — CID 46495454
(5Z)-5-(7-bromo-1,5-dimethyl-2-oxoindol-3-ylidene)-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 46495454) has the molecular formula C25H18BrN3O2S and a molecular weight of 504.41 g/mol. Its IUPAC name is (5Z)-5-(7-bromo-1,5-dimethyl-2-oxoindol-3-ylidene)-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-(7-bromo-1,5-dimethyl-2-oxoindol-3-ylidene)-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 46495454 |
| Molecular Formula | C25H18BrN3O2S |
| Molecular Weight | 504.41 g/mol |
| Exact Mass | 503.03 |
| IUPAC Name | (5Z)-5-(7-bromo-1,5-dimethyl-2-oxoindol-3-ylidene)-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(Br)c2c(c1)/C(=C1/S/C(=N\c3ccccc3)N(c3ccccc3)C1=O)C(=O)N2C |
| InChI | InChI=1S/C25H18BrN3O2S/c1-15-13-18-20(23(30)28(2)21(18)19(26)14-15)22-24(31)29(17-11-7-4-8-12-17)25(32-22)27-16-9-5-3-6-10-16/h3-14H,1-2H3/b22-20-,27-25- |
| InChIKey | CTNFIRKYEKUHGB-WKHIKGPMSA-N |
| XLogP | 5.91 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.41 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|