C24H27N7S — CID 46559664
5-(4-methylphenyl)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 46559664) has the molecular formula C24H27N7S and a molecular weight of 445.60 g/mol. Its IUPAC name is 5-(4-methylphenyl)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 5-(4-methylphenyl)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 46559664 |
| Molecular Formula | C24H27N7S |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 5-(4-methylphenyl)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1ccc(-c2csc3ncnc(NCCCN4CCN(c5ncccn5)CC4)c23)cc1 |
| InChI | InChI=1S/C24H27N7S/c1-18-4-6-19(7-5-18)20-16-32-23-21(20)22(28-17-29-23)25-10-3-11-30-12-14-31(15-13-30)24-26-8-2-9-27-24/h2,4-9,16-17H,3,10-15H2,1H3,(H,25,28,29) |
| InChIKey | OVLRFKUVLDMRCO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|