C17H15BrClN5O2S — CID 46572571
N-[3-[5-[2-(2-bromo-4-chlorophenoxy)ethylsulfanyl]tetrazol-1-yl]phenyl]acetamide (PubChem CID 46572571) has the molecular formula C17H15BrClN5O2S and a molecular weight of 468.76 g/mol. Its IUPAC name is N-[3-[5-[2-(2-bromo-4-chlorophenoxy)ethylsulfanyl]tetrazol-1-yl]phenyl]acetamide.
| Compound Name | N-[3-[5-[2-(2-bromo-4-chlorophenoxy)ethylsulfanyl]tetrazol-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 46572571 |
| Molecular Formula | C17H15BrClN5O2S |
| Molecular Weight | 468.76 g/mol |
| Exact Mass | 466.98 |
| IUPAC Name | N-[3-[5-[2-(2-bromo-4-chlorophenoxy)ethylsulfanyl]tetrazol-1-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(-n2nnnc2SCCOc2ccc(Cl)cc2Br)c1 |
| InChI | InChI=1S/C17H15BrClN5O2S/c1-11(25)20-13-3-2-4-14(10-13)24-17(21-22-23-24)27-8-7-26-16-6-5-12(19)9-15(16)18/h2-6,9-10H,7-8H2,1H3,(H,20,25) |
| InChIKey | GYSXNSKRJMYEEX-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.76 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|