C16H18N2O6S2 — CID 46648550
[2-(4-hydroxyanilino)-2-oxoethyl] 5-[2-(methanesulfonamido)ethyl]thiophene-2-carboxylate (PubChem CID 46648550) has the molecular formula C16H18N2O6S2 and a molecular weight of 398.46 g/mol. Its IUPAC name is [2-(4-hydroxyanilino)-2-oxoethyl] 5-[2-(methanesulfonamido)ethyl]thiophene-2-carboxylate.
| Compound Name | [2-(4-hydroxyanilino)-2-oxoethyl] 5-[2-(methanesulfonamido)ethyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 46648550 |
| Molecular Formula | C16H18N2O6S2 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | [2-(4-hydroxyanilino)-2-oxoethyl] 5-[2-(methanesulfonamido)ethyl]thiophene-2-carboxylate |
| SMILES | CS(=O)(=O)NCCc1ccc(C(=O)OCC(=O)Nc2ccc(O)cc2)s1 |
| InChI | InChI=1S/C16H18N2O6S2/c1-26(22,23)17-9-8-13-6-7-14(25-13)16(21)24-10-15(20)18-11-2-4-12(19)5-3-11/h2-7,17,19H,8-10H2,1H3,(H,18,20) |
| InChIKey | WHGHXRYAGHGEIU-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|