C15H19ClN4O3S4 — CID 4664975
2-[(4-chlorophenyl)sulfonylamino]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-methylsulfanylbutanamide (PubChem CID 4664975) has the molecular formula C15H19ClN4O3S4 and a molecular weight of 467.06 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonylamino]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-methylsulfanylbutanamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonylamino]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 4664975 |
| Molecular Formula | C15H19ClN4O3S4 |
| Molecular Weight | 467.06 g/mol |
| Exact Mass | 466.00 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonylamino]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-methylsulfanylbutanamide |
| SMILES | CCSc1nnc(NC(=O)C(CCSC)NS(=O)(=O)c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C15H19ClN4O3S4/c1-3-25-15-19-18-14(26-15)17-13(21)12(8-9-24-2)20-27(22,23)11-6-4-10(16)5-7-11/h4-7,12,20H,3,8-9H2,1-2H3,(H,17,18,21) |
| InChIKey | KUISHFOXPIDQLI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.06 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|