C21H16ClN3O — CID 46847351
5-(benzylamino)-3-(4-chlorophenyl)-1H-1,6-naphthyridin-4-one (PubChem CID 46847351) has the molecular formula C21H16ClN3O and a molecular weight of 361.83 g/mol. Its IUPAC name is 5-(benzylamino)-3-(4-chlorophenyl)-1H-1,6-naphthyridin-4-one.
| Compound Name | 5-(benzylamino)-3-(4-chlorophenyl)-1H-1,6-naphthyridin-4-one |
|---|---|
| PubChem CID | 46847351 |
| Molecular Formula | C21H16ClN3O |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 5-(benzylamino)-3-(4-chlorophenyl)-1H-1,6-naphthyridin-4-one |
| SMILES | O=c1c(-c2ccc(Cl)cc2)c[nH]c2ccnc(NCc3ccccc3)c12 |
| InChI | InChI=1S/C21H16ClN3O/c22-16-8-6-15(7-9-16)17-13-24-18-10-11-23-21(19(18)20(17)26)25-12-14-4-2-1-3-5-14/h1-11,13H,12H2,(H,23,25)(H,24,26) |
| InChIKey | VYWGHOZLMLMUQK-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |