C21H16ClN5 — CID 22118832
N-benzyl-6-(4-chlorophenyl)-3-pyridin-3-yl-1,2,4-triazin-5-amine (PubChem CID 22118832) has the molecular formula C21H16ClN5 and a molecular weight of 373.85 g/mol. Its IUPAC name is N-benzyl-6-(4-chlorophenyl)-3-pyridin-3-yl-1,2,4-triazin-5-amine.
| Compound Name | N-benzyl-6-(4-chlorophenyl)-3-pyridin-3-yl-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 22118832 |
| Molecular Formula | C21H16ClN5 |
| Molecular Weight | 373.85 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | N-benzyl-6-(4-chlorophenyl)-3-pyridin-3-yl-1,2,4-triazin-5-amine |
| SMILES | Clc1ccc(-c2nnc(-c3cccnc3)nc2NCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H16ClN5/c22-18-10-8-16(9-11-18)19-21(24-13-15-5-2-1-3-6-15)25-20(27-26-19)17-7-4-12-23-14-17/h1-12,14H,13H2,(H,24,25,27) |
| InChIKey | KWWVUJSDRLCKAV-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.85 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |