C23H26INO5S — CID 46861901
(2R,6R)-4-butyl-2-(iodomethyl)-5-(4-methylphenyl)sulfonyl-6-(4-nitrophenyl)-3,6-dihydro-2H-pyran (PubChem CID 46861901) has the molecular formula C23H26INO5S and a molecular weight of 555.43 g/mol. Its IUPAC name is (2R,6R)-4-butyl-2-(iodomethyl)-5-(4-methylphenyl)sulfonyl-6-(4-nitrophenyl)-3,6-dihydro-2H-pyran.
| Compound Name | (2R,6R)-4-butyl-2-(iodomethyl)-5-(4-methylphenyl)sulfonyl-6-(4-nitrophenyl)-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 46861901 |
| Molecular Formula | C23H26INO5S |
| Molecular Weight | 555.43 g/mol |
| Exact Mass | 555.06 |
| IUPAC Name | (2R,6R)-4-butyl-2-(iodomethyl)-5-(4-methylphenyl)sulfonyl-6-(4-nitrophenyl)-3,6-dihydro-2H-pyran |
| SMILES | CCCCC1=C(S(=O)(=O)c2ccc(C)cc2)[C@@H](c2ccc([N+](=O)[O-])cc2)O[C@@H](CI)C1 |
| InChI | InChI=1S/C23H26INO5S/c1-3-4-5-18-14-20(15-24)30-22(17-8-10-19(11-9-17)25(26)27)23(18)31(28,29)21-12-6-16(2)7-13-21/h6-13,20,22H,3-5,14-15H2,1-2H3/t20-,22-/m1/s1 |
| InChIKey | VJILHVBQAURBQA-IFMALSPDSA-N |
| XLogP | 6.09 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.43 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|