C28H34N4O6S2 — CID 46864723
[4-[(2S)-2-(4-cyclohexyl-1,3-thiazol-2-yl)-2-[[(2S)-2-(methoxycarbonylamino)-3-phenylpropanoyl]amino]ethyl]phenyl]sulfamic acid (PubChem CID 46864723) has the molecular formula C28H34N4O6S2 and a molecular weight of 586.74 g/mol. Its IUPAC name is [4-[(2S)-2-(4-cyclohexyl-1,3-thiazol-2-yl)-2-[[(2S)-2-(methoxycarbonylamino)-3-phenylpropanoyl]amino]ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[(2S)-2-(4-cyclohexyl-1,3-thiazol-2-yl)-2-[[(2S)-2-(methoxycarbonylamino)-3-phenylpropanoyl]amino]ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 46864723 |
| Molecular Formula | C28H34N4O6S2 |
| Molecular Weight | 586.74 g/mol |
| Exact Mass | 586.19 |
| IUPAC Name | [4-[(2S)-2-(4-cyclohexyl-1,3-thiazol-2-yl)-2-[[(2S)-2-(methoxycarbonylamino)-3-phenylpropanoyl]amino]ethyl]phenyl]sulfamic acid |
| SMILES | COC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccc(NS(=O)(=O)O)cc1)c1nc(C2CCCCC2)cs1 |
| InChI | InChI=1S/C28H34N4O6S2/c1-38-28(34)31-23(16-19-8-4-2-5-9-19)26(33)29-24(17-20-12-14-22(15-13-20)32-40(35,36)37)27-30-25(18-39-27)21-10-6-3-7-11-21/h2,4-5,8-9,12-15,18,21,23-24,32H,3,6-7,10-11,16-17H2,1H3,(H,29,33)(H,31,34)(H,35,36,37)/t23-,24-/m0/s1 |
| InChIKey | OMJLGUFRLBKFON-ZEQRLZLVSA-N |
| XLogP | 4.77 |
| TPSA | 146.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.74 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|