C22H17F2NO — CID 46880669
(E)-3-(2,6-difluorophenyl)-1-[5-(2,3-dimethylphenyl)-2-pyridinyl]prop-2-en-1-one (PubChem CID 46880669) has the molecular formula C22H17F2NO and a molecular weight of 349.38 g/mol. Its IUPAC name is (E)-3-(2,6-difluorophenyl)-1-[5-(2,3-dimethylphenyl)-2-pyridinyl]prop-2-en-1-one.
| Compound Name | (E)-3-(2,6-difluorophenyl)-1-[5-(2,3-dimethylphenyl)-2-pyridinyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 46880669 |
| Molecular Formula | C22H17F2NO |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | (E)-3-(2,6-difluorophenyl)-1-[5-(2,3-dimethylphenyl)-2-pyridinyl]prop-2-en-1-one |
| SMILES | Cc1cccc(-c2ccc(C(=O)/C=C/c3c(F)cccc3F)nc2)c1C |
| InChI | InChI=1S/C22H17F2NO/c1-14-5-3-6-17(15(14)2)16-9-11-21(25-13-16)22(26)12-10-18-19(23)7-4-8-20(18)24/h3-13H,1-2H3/b12-10+ |
| InChIKey | VWNXQXGELIYDHP-ZRDIBKRKSA-N |
| XLogP | 5.54 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|