C22H25N3OS — CID 46893028
N-[4-[[benzyl(butyl)amino]methyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 46893028) has the molecular formula C22H25N3OS and a molecular weight of 379.53 g/mol. Its IUPAC name is N-[4-[[benzyl(butyl)amino]methyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | N-[4-[[benzyl(butyl)amino]methyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 46893028 |
| Molecular Formula | C22H25N3OS |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | N-[4-[[benzyl(butyl)amino]methyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | CCCCN(Cc1ccccc1)Cc1csc(NC(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C22H25N3OS/c1-2-3-14-25(15-18-10-6-4-7-11-18)16-20-17-27-22(23-20)24-21(26)19-12-8-5-9-13-19/h4-13,17H,2-3,14-16H2,1H3,(H,23,24,26) |
| InChIKey | WKWNDVCYOCTKIP-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |