C23H30N2O2 — CID 46910477
1-(4-methoxyphenyl)-4-[(2S)-2,4,6,7-tetramethyl-2,3-dihydro-1-benzofuran-5-yl]piperazine (PubChem CID 46910477) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-4-[(2S)-2,4,6,7-tetramethyl-2,3-dihydro-1-benzofuran-5-yl]piperazine.
| Compound Name | 1-(4-methoxyphenyl)-4-[(2S)-2,4,6,7-tetramethyl-2,3-dihydro-1-benzofuran-5-yl]piperazine |
|---|---|
| PubChem CID | 46910477 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 1-(4-methoxyphenyl)-4-[(2S)-2,4,6,7-tetramethyl-2,3-dihydro-1-benzofuran-5-yl]piperazine |
| SMILES | COc1ccc(N2CCN(c3c(C)c(C)c4c(c3C)C[C@H](C)O4)CC2)cc1 |
| InChI | InChI=1S/C23H30N2O2/c1-15-14-21-18(4)22(16(2)17(3)23(21)27-15)25-12-10-24(11-13-25)19-6-8-20(26-5)9-7-19/h6-9,15H,10-14H2,1-5H3/t15-/m0/s1 |
| InChIKey | YVBZPAWLIVCPHA-HNNXBMFYSA-N |
| XLogP | 4.27 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|