C30H37N3O — CID 10813650
2-[(4-benzhydrylpiperazin-1-yl)methyl]-2,4,6,7-tetramethyl-3H-1-benzofuran-5-amine (PubChem CID 10813650) has the molecular formula C30H37N3O and a molecular weight of 455.65 g/mol. Its IUPAC name is 2-[(4-benzhydrylpiperazin-1-yl)methyl]-2,4,6,7-tetramethyl-3H-1-benzofuran-5-amine.
| Compound Name | 2-[(4-benzhydrylpiperazin-1-yl)methyl]-2,4,6,7-tetramethyl-3H-1-benzofuran-5-amine |
|---|---|
| PubChem CID | 10813650 |
| Molecular Formula | C30H37N3O |
| Molecular Weight | 455.65 g/mol |
| Exact Mass | 455.29 |
| IUPAC Name | 2-[(4-benzhydrylpiperazin-1-yl)methyl]-2,4,6,7-tetramethyl-3H-1-benzofuran-5-amine |
| SMILES | Cc1c(C)c2c(c(C)c1N)CC(C)(CN1CCN(C(c3ccccc3)c3ccccc3)CC1)O2 |
| InChI | InChI=1S/C30H37N3O/c1-21-22(2)29-26(23(3)27(21)31)19-30(4,34-29)20-32-15-17-33(18-16-32)28(24-11-7-5-8-12-24)25-13-9-6-10-14-25/h5-14,28H,15-20,31H2,1-4H3 |
| InChIKey | MVSGXQSDPNEATA-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.65 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|