C15H12Cl2N2O — CID 46929408
(4R)-4-benzyl-2-(5,6-dichloro-3-pyridinyl)-4,5-dihydro-1,3-oxazole (PubChem CID 46929408) has the molecular formula C15H12Cl2N2O and a molecular weight of 307.18 g/mol. Its IUPAC name is (4R)-4-benzyl-2-(5,6-dichloro-3-pyridinyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | (4R)-4-benzyl-2-(5,6-dichloro-3-pyridinyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 46929408 |
| Molecular Formula | C15H12Cl2N2O |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | (4R)-4-benzyl-2-(5,6-dichloro-3-pyridinyl)-4,5-dihydro-1,3-oxazole |
| SMILES | Clc1cc(C2=N[C@H](Cc3ccccc3)CO2)cnc1Cl |
| InChI | InChI=1S/C15H12Cl2N2O/c16-13-7-11(8-18-14(13)17)15-19-12(9-20-15)6-10-4-2-1-3-5-10/h1-5,7-8,12H,6,9H2/t12-/m1/s1 |
| InChIKey | SNTZJMLUDAUMJR-GFCCVEGCSA-N |
| XLogP | 3.78 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|