C11H9NO5 — CID 46949718
(5-cyano-7-methoxy-1,3-benzodioxol-4-yl) acetate (PubChem CID 46949718) has the molecular formula C11H9NO5 and a molecular weight of 235.19 g/mol. Its IUPAC name is (5-cyano-7-methoxy-1,3-benzodioxol-4-yl) acetate.
| Compound Name | (5-cyano-7-methoxy-1,3-benzodioxol-4-yl) acetate |
|---|---|
| PubChem CID | 46949718 |
| Molecular Formula | C11H9NO5 |
| Molecular Weight | 235.19 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | (5-cyano-7-methoxy-1,3-benzodioxol-4-yl) acetate |
| SMILES | COc1cc(C#N)c(OC(C)=O)c2c1OCO2 |
| InChI | InChI=1S/C11H9NO5/c1-6(13)17-9-7(4-12)3-8(14-2)10-11(9)16-5-15-10/h3H,5H2,1-2H3 |
| InChIKey | KNOCSGBYKRYSBI-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.19 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|