C13H12Cl2FN3S — CID 47014143
N-[(2-chloro-6-fluorophenyl)methyl]-N-[(5-chlorothiadiazol-4-yl)methyl]cyclopropanamine (PubChem CID 47014143) has the molecular formula C13H12Cl2FN3S and a molecular weight of 332.23 g/mol. Its IUPAC name is N-[(2-chloro-6-fluorophenyl)methyl]-N-[(5-chlorothiadiazol-4-yl)methyl]cyclopropanamine.
| Compound Name | N-[(2-chloro-6-fluorophenyl)methyl]-N-[(5-chlorothiadiazol-4-yl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 47014143 |
| Molecular Formula | C13H12Cl2FN3S |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | N-[(2-chloro-6-fluorophenyl)methyl]-N-[(5-chlorothiadiazol-4-yl)methyl]cyclopropanamine |
| SMILES | Fc1cccc(Cl)c1CN(Cc1nnsc1Cl)C1CC1 |
| InChI | InChI=1S/C13H12Cl2FN3S/c14-10-2-1-3-11(16)9(10)6-19(8-4-5-8)7-12-13(15)20-18-17-12/h1-3,8H,4-7H2 |
| InChIKey | NPPVTRMKHHULEI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |