C19H21N5O2 — CID 47080477
1,3-dimethyl-2,4-dioxo-6-[(2,3,5-trimethyl-1H-indol-7-yl)methylamino]pyrimidine-5-carbonitrile (PubChem CID 47080477) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is 1,3-dimethyl-2,4-dioxo-6-[(2,3,5-trimethyl-1H-indol-7-yl)methylamino]pyrimidine-5-carbonitrile.
| Compound Name | 1,3-dimethyl-2,4-dioxo-6-[(2,3,5-trimethyl-1H-indol-7-yl)methylamino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 47080477 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 1,3-dimethyl-2,4-dioxo-6-[(2,3,5-trimethyl-1H-indol-7-yl)methylamino]pyrimidine-5-carbonitrile |
| SMILES | Cc1cc(CNc2c(C#N)c(=O)n(C)c(=O)n2C)c2[nH]c(C)c(C)c2c1 |
| InChI | InChI=1S/C19H21N5O2/c1-10-6-13(16-14(7-10)11(2)12(3)22-16)9-21-17-15(8-20)18(25)24(5)19(26)23(17)4/h6-7,21-22H,9H2,1-5H3 |
| InChIKey | YQCOEUYCIMRJSS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 95.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|