C19H23ClN4O5S — CID 47081847
1-(3-chloro-2,6-diethylphenyl)-3-[2-[(3-nitrophenyl)sulfonylamino]ethyl]urea (PubChem CID 47081847) has the molecular formula C19H23ClN4O5S and a molecular weight of 454.94 g/mol. Its IUPAC name is 1-(3-chloro-2,6-diethylphenyl)-3-[2-[(3-nitrophenyl)sulfonylamino]ethyl]urea.
| Compound Name | 1-(3-chloro-2,6-diethylphenyl)-3-[2-[(3-nitrophenyl)sulfonylamino]ethyl]urea |
|---|---|
| PubChem CID | 47081847 |
| Molecular Formula | C19H23ClN4O5S |
| Molecular Weight | 454.94 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 1-(3-chloro-2,6-diethylphenyl)-3-[2-[(3-nitrophenyl)sulfonylamino]ethyl]urea |
| SMILES | CCc1ccc(Cl)c(CC)c1NC(=O)NCCNS(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H23ClN4O5S/c1-3-13-8-9-17(20)16(4-2)18(13)23-19(25)21-10-11-22-30(28,29)15-7-5-6-14(12-15)24(26)27/h5-9,12,22H,3-4,10-11H2,1-2H3,(H2,21,23,25) |
| InChIKey | IZWLMDSRIJIAJZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.94 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|