C28H41NO6 — CID 4728885
[1-[2-(1-adamantyl)ethoxy]-3-morpholin-4-ylpropan-2-yl] 3,4-dimethoxybenzoate (PubChem CID 4728885) has the molecular formula C28H41NO6 and a molecular weight of 487.64 g/mol. Its IUPAC name is [1-[2-(1-adamantyl)ethoxy]-3-morpholin-4-ylpropan-2-yl] 3,4-dimethoxybenzoate.
| Compound Name | [1-[2-(1-adamantyl)ethoxy]-3-morpholin-4-ylpropan-2-yl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 4728885 |
| Molecular Formula | C28H41NO6 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.29 |
| IUPAC Name | [1-[2-(1-adamantyl)ethoxy]-3-morpholin-4-ylpropan-2-yl] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)OC(COCCC23CC4CC(CC(C4)C2)C3)CN2CCOCC2)cc1OC |
| InChI | InChI=1S/C28H41NO6/c1-31-25-4-3-23(14-26(25)32-2)27(30)35-24(18-29-6-9-33-10-7-29)19-34-8-5-28-15-20-11-21(16-28)13-22(12-20)17-28/h3-4,14,20-22,24H,5-13,15-19H2,1-2H3 |
| InChIKey | GIRXEVQVMKSWIG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|