C12H7Cl3NO2S- — CID 4740400
(4-chlorophenyl)sulfonyl-(2,5-dichlorophenyl)azanide (PubChem CID 4740400) has the molecular formula C12H7Cl3NO2S- and a molecular weight of 335.62 g/mol. Its IUPAC name is (4-chlorophenyl)sulfonyl-(2,5-dichlorophenyl)azanide.
| Compound Name | (4-chlorophenyl)sulfonyl-(2,5-dichlorophenyl)azanide |
|---|---|
| PubChem CID | 4740400 |
| Molecular Formula | C12H7Cl3NO2S- |
| Molecular Weight | 335.62 g/mol |
| Exact Mass | 333.93 |
| IUPAC Name | (4-chlorophenyl)sulfonyl-(2,5-dichlorophenyl)azanide |
| SMILES | O=S(=O)([N-]c1cc(Cl)ccc1Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H7Cl3NO2S/c13-8-1-4-10(5-2-8)19(17,18)16-12-7-9(14)3-6-11(12)15/h1-7H/q-1 |
| InChIKey | AOVFMCMDBBAZIV-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 48.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.62 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |