C11H14N8O3 — CID 4773069
N-[(1,5-dimethylpyrazol-4-yl)methylideneamino]-3-(3-nitro-1,2,4-triazol-1-yl)propanamide (PubChem CID 4773069) has the molecular formula C11H14N8O3 and a molecular weight of 306.29 g/mol. Its IUPAC name is N-[(1,5-dimethylpyrazol-4-yl)methylideneamino]-3-(3-nitro-1,2,4-triazol-1-yl)propanamide.
| Compound Name | N-[(1,5-dimethylpyrazol-4-yl)methylideneamino]-3-(3-nitro-1,2,4-triazol-1-yl)propanamide |
|---|---|
| PubChem CID | 4773069 |
| Molecular Formula | C11H14N8O3 |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | N-[(1,5-dimethylpyrazol-4-yl)methylideneamino]-3-(3-nitro-1,2,4-triazol-1-yl)propanamide |
| SMILES | Cc1c(C=NNC(=O)CCn2cnc([N+](=O)[O-])n2)cnn1C |
| InChI | InChI=1S/C11H14N8O3/c1-8-9(6-14-17(8)2)5-13-15-10(20)3-4-18-7-12-11(16-18)19(21)22/h5-7H,3-4H2,1-2H3,(H,15,20) |
| InChIKey | BLYKGMHCTVBVBR-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 133.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|