C23H22ClN3O2S — CID 4790910
7-chloro-2-[1-(3,4-dihydro-2H-quinolin-1-yl)-1-oxopropan-2-yl]sulfanyl-3-prop-2-enylquinazolin-4-one (PubChem CID 4790910) has the molecular formula C23H22ClN3O2S and a molecular weight of 439.97 g/mol. Its IUPAC name is 7-chloro-2-[1-(3,4-dihydro-2H-quinolin-1-yl)-1-oxopropan-2-yl]sulfanyl-3-prop-2-enylquinazolin-4-one.
| Compound Name | 7-chloro-2-[1-(3,4-dihydro-2H-quinolin-1-yl)-1-oxopropan-2-yl]sulfanyl-3-prop-2-enylquinazolin-4-one |
|---|---|
| PubChem CID | 4790910 |
| Molecular Formula | C23H22ClN3O2S |
| Molecular Weight | 439.97 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | 7-chloro-2-[1-(3,4-dihydro-2H-quinolin-1-yl)-1-oxopropan-2-yl]sulfanyl-3-prop-2-enylquinazolin-4-one |
| SMILES | C=CCn1c(SC(C)C(=O)N2CCCc3ccccc32)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C23H22ClN3O2S/c1-3-12-27-22(29)18-11-10-17(24)14-19(18)25-23(27)30-15(2)21(28)26-13-6-8-16-7-4-5-9-20(16)26/h3-5,7,9-11,14-15H,1,6,8,12-13H2,2H3 |
| InChIKey | YDKVAKMORIRKFM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.97 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|