C12H10F2N2O3S2 — CID 47952038
N'-(3,4-difluorophenyl)sulfonyl-5-methylthiophene-2-carbohydrazide (PubChem CID 47952038) has the molecular formula C12H10F2N2O3S2 and a molecular weight of 332.35 g/mol. Its IUPAC name is N'-(3,4-difluorophenyl)sulfonyl-5-methylthiophene-2-carbohydrazide.
| Compound Name | N'-(3,4-difluorophenyl)sulfonyl-5-methylthiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 47952038 |
| Molecular Formula | C12H10F2N2O3S2 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | N'-(3,4-difluorophenyl)sulfonyl-5-methylthiophene-2-carbohydrazide |
| SMILES | Cc1ccc(C(=O)NNS(=O)(=O)c2ccc(F)c(F)c2)s1 |
| InChI | InChI=1S/C12H10F2N2O3S2/c1-7-2-5-11(20-7)12(17)15-16-21(18,19)8-3-4-9(13)10(14)6-8/h2-6,16H,1H3,(H,15,17) |
| InChIKey | YBPPMRGFSNCDIC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|