C12H11F8N3O2S — CID 123137150
N-[(3,4-difluorophenyl)sulfonylamino]-N'-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)ethanimidamide (PubChem CID 123137150) has the molecular formula C12H11F8N3O2S and a molecular weight of 413.29 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)sulfonylamino]-N'-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)ethanimidamide.
| Compound Name | N-[(3,4-difluorophenyl)sulfonylamino]-N'-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)ethanimidamide |
|---|---|
| PubChem CID | 123137150 |
| Molecular Formula | C12H11F8N3O2S |
| Molecular Weight | 413.29 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | N-[(3,4-difluorophenyl)sulfonylamino]-N'-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)ethanimidamide |
| SMILES | C/C(=N\C(C)(C(F)(F)F)C(F)(F)F)NNS(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H11F8N3O2S/c1-6(21-10(2,11(15,16)17)12(18,19)20)22-23-26(24,25)7-3-4-8(13)9(14)5-7/h3-5,23H,1-2H3,(H,21,22) |
| InChIKey | BCQJJOFLPMXTBC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.29 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|