C14H13F2NO3S2 — CID 91817409
N-[2-(5-acetylthiophen-2-yl)ethyl]-3,4-difluorobenzenesulfonamide (PubChem CID 91817409) has the molecular formula C14H13F2NO3S2 and a molecular weight of 345.39 g/mol. Its IUPAC name is N-[2-(5-acetylthiophen-2-yl)ethyl]-3,4-difluorobenzenesulfonamide.
| Compound Name | N-[2-(5-acetylthiophen-2-yl)ethyl]-3,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 91817409 |
| Molecular Formula | C14H13F2NO3S2 |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | N-[2-(5-acetylthiophen-2-yl)ethyl]-3,4-difluorobenzenesulfonamide |
| SMILES | CC(=O)c1ccc(CCNS(=O)(=O)c2ccc(F)c(F)c2)s1 |
| InChI | InChI=1S/C14H13F2NO3S2/c1-9(18)14-5-2-10(21-14)6-7-17-22(19,20)11-3-4-12(15)13(16)8-11/h2-5,8,17H,6-7H2,1H3 |
| InChIKey | OZJXYZGBVQQHON-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |