C30H30N2O2S2 — CID 4832604
[3-(benzylsulfanylmethyl)-1-benzofuran-2-yl]-[2-(2-propan-2-ylphenyl)imino-1,3-thiazinan-3-yl]methanone (PubChem CID 4832604) has the molecular formula C30H30N2O2S2 and a molecular weight of 514.72 g/mol. Its IUPAC name is [3-(benzylsulfanylmethyl)-1-benzofuran-2-yl]-[2-(2-propan-2-ylphenyl)imino-1,3-thiazinan-3-yl]methanone.
| Compound Name | [3-(benzylsulfanylmethyl)-1-benzofuran-2-yl]-[2-(2-propan-2-ylphenyl)imino-1,3-thiazinan-3-yl]methanone |
|---|---|
| PubChem CID | 4832604 |
| Molecular Formula | C30H30N2O2S2 |
| Molecular Weight | 514.72 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | [3-(benzylsulfanylmethyl)-1-benzofuran-2-yl]-[2-(2-propan-2-ylphenyl)imino-1,3-thiazinan-3-yl]methanone |
| SMILES | CC(C)c1ccccc1/N=C1\SCCCN1C(=O)c1oc2ccccc2c1CSCc1ccccc1 |
| InChI | InChI=1S/C30H30N2O2S2/c1-21(2)23-13-6-8-15-26(23)31-30-32(17-10-18-36-30)29(33)28-25(24-14-7-9-16-27(24)34-28)20-35-19-22-11-4-3-5-12-22/h3-9,11-16,21H,10,17-20H2,1-2H3/b31-30- |
| InChIKey | BZCVWTXTVQSESE-KTMFPKCZSA-N |
| XLogP | 8.26 |
| TPSA | 45.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.72 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|