C23H17F5N2O3S — CID 4836193
1-[4-(difluoromethoxy)phenyl]-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]-3-sulfanylidene-3-[3-(trifluoromethyl)anilino]prop-1-en-1-olate (PubChem CID 4836193) has the molecular formula C23H17F5N2O3S and a molecular weight of 496.46 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]-3-sulfanylidene-3-[3-(trifluoromethyl)anilino]prop-1-en-1-olate.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]-3-sulfanylidene-3-[3-(trifluoromethyl)anilino]prop-1-en-1-olate |
|---|---|
| PubChem CID | 4836193 |
| Molecular Formula | C23H17F5N2O3S |
| Molecular Weight | 496.46 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]-3-sulfanylidene-3-[3-(trifluoromethyl)anilino]prop-1-en-1-olate |
| SMILES | [O-]C(=C(C(=S)Nc1cccc(C(F)(F)F)c1)[n+]1cccc(CO)c1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C23H17F5N2O3S/c24-22(25)33-18-8-6-15(7-9-18)20(32)19(30-10-2-3-14(12-30)13-31)21(34)29-17-5-1-4-16(11-17)23(26,27)28/h1-12,22,31H,13H2,(H-,29,32,34) |
| InChIKey | LDFKYXFRARNPAG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 68.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|