C21H16N4O8 — CID 4847128
[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 6-methyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxylate (PubChem CID 4847128) has the molecular formula C21H16N4O8 and a molecular weight of 452.38 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 6-methyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxylate.
| Compound Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 6-methyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxylate |
|---|---|
| PubChem CID | 4847128 |
| Molecular Formula | C21H16N4O8 |
| Molecular Weight | 452.38 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 6-methyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxylate |
| SMILES | Cc1cc(=O)c(C(=O)OCC(=O)Nc2ccc3c(c2)OCO3)nn1-c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H16N4O8/c1-12-8-16(26)20(23-24(12)14-4-2-3-5-15(14)25(29)30)21(28)31-10-19(27)22-13-6-7-17-18(9-13)33-11-32-17/h2-9H,10-11H2,1H3,(H,22,27) |
| InChIKey | BUMKEYCOKXIZCC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 151.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|