C10H14N2O5S2 — CID 4974390
2-(2,4-dioxo-1,3-thiazolidin-5-yl)-N-(1,1-dioxothiolan-3-yl)-N-methylacetamide (PubChem CID 4974390) has the molecular formula C10H14N2O5S2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-thiazolidin-5-yl)-N-(1,1-dioxothiolan-3-yl)-N-methylacetamide.
| Compound Name | 2-(2,4-dioxo-1,3-thiazolidin-5-yl)-N-(1,1-dioxothiolan-3-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 4974390 |
| Molecular Formula | C10H14N2O5S2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 2-(2,4-dioxo-1,3-thiazolidin-5-yl)-N-(1,1-dioxothiolan-3-yl)-N-methylacetamide |
| SMILES | CN(C(=O)CC1SC(=O)NC1=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H14N2O5S2/c1-12(6-2-3-19(16,17)5-6)8(13)4-7-9(14)11-10(15)18-7/h6-7H,2-5H2,1H3,(H,11,14,15) |
| InChIKey | GCHBAXWCLMCIJS-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|