C23H22N6O3S — CID 4992404
2-[1-(2,1,3-benzoxadiazole-5-carbonyl)piperidin-4-yl]-N'-methyl-N'-phenyl-1,3-thiazole-4-carbohydrazide (PubChem CID 4992404) has the molecular formula C23H22N6O3S and a molecular weight of 462.54 g/mol. Its IUPAC name is 2-[1-(2,1,3-benzoxadiazole-5-carbonyl)piperidin-4-yl]-N'-methyl-N'-phenyl-1,3-thiazole-4-carbohydrazide.
| Compound Name | 2-[1-(2,1,3-benzoxadiazole-5-carbonyl)piperidin-4-yl]-N'-methyl-N'-phenyl-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 4992404 |
| Molecular Formula | C23H22N6O3S |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 2-[1-(2,1,3-benzoxadiazole-5-carbonyl)piperidin-4-yl]-N'-methyl-N'-phenyl-1,3-thiazole-4-carbohydrazide |
| SMILES | CN(NC(=O)c1csc(C2CCN(C(=O)c3ccc4nonc4c3)CC2)n1)c1ccccc1 |
| InChI | InChI=1S/C23H22N6O3S/c1-28(17-5-3-2-4-6-17)25-21(30)20-14-33-22(24-20)15-9-11-29(12-10-15)23(31)16-7-8-18-19(13-16)27-32-26-18/h2-8,13-15H,9-12H2,1H3,(H,25,30) |
| InChIKey | BPRYIALKAWFSBE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|