C21H14Cl2NO3- — CID 5008293
3-[[2,2-bis(4-chlorophenyl)acetyl]amino]benzoate (PubChem CID 5008293) has the molecular formula C21H14Cl2NO3- and a molecular weight of 399.25 g/mol. Its IUPAC name is 3-[[2,2-bis(4-chlorophenyl)acetyl]amino]benzoate.
| Compound Name | 3-[[2,2-bis(4-chlorophenyl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 5008293 |
| Molecular Formula | C21H14Cl2NO3- |
| Molecular Weight | 399.25 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | 3-[[2,2-bis(4-chlorophenyl)acetyl]amino]benzoate |
| SMILES | O=C([O-])c1cccc(NC(=O)C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C21H15Cl2NO3/c22-16-8-4-13(5-9-16)19(14-6-10-17(23)11-7-14)20(25)24-18-3-1-2-15(12-18)21(26)27/h1-12,19H,(H,24,25)(H,26,27)/p-1 |
| InChIKey | OYEIBTUZESSEEE-UHFFFAOYSA-M |
| XLogP | 4.13 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.25 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |