C8H7Br2ClN2O3 — CID 5047509
2,6-dibromo-N-(chloromethoxymethyl)-4-nitroaniline (PubChem CID 5047509) has the molecular formula C8H7Br2ClN2O3 and a molecular weight of 374.42 g/mol. Its IUPAC name is 2,6-dibromo-N-(chloromethoxymethyl)-4-nitroaniline.
| Compound Name | 2,6-dibromo-N-(chloromethoxymethyl)-4-nitroaniline |
|---|---|
| PubChem CID | 5047509 |
| Molecular Formula | C8H7Br2ClN2O3 |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 371.85 |
| IUPAC Name | 2,6-dibromo-N-(chloromethoxymethyl)-4-nitroaniline |
| SMILES | O=[N+]([O-])c1cc(Br)c(NCOCCl)c(Br)c1 |
| InChI | InChI=1S/C8H7Br2ClN2O3/c9-6-1-5(13(14)15)2-7(10)8(6)12-4-16-3-11/h1-2,12H,3-4H2 |
| InChIKey | UBVGDQPRJOCXQF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|