C18H13F3N2O4S — CID 5048718
N-phenyl-5-[[5-(trifluoromethyl)-2-pyridinyl]sulfonylmethyl]furan-2-carboxamide (PubChem CID 5048718) has the molecular formula C18H13F3N2O4S and a molecular weight of 410.37 g/mol. Its IUPAC name is N-phenyl-5-[[5-(trifluoromethyl)-2-pyridinyl]sulfonylmethyl]furan-2-carboxamide.
| Compound Name | N-phenyl-5-[[5-(trifluoromethyl)-2-pyridinyl]sulfonylmethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 5048718 |
| Molecular Formula | C18H13F3N2O4S |
| Molecular Weight | 410.37 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | N-phenyl-5-[[5-(trifluoromethyl)-2-pyridinyl]sulfonylmethyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1ccc(CS(=O)(=O)c2ccc(C(F)(F)F)cn2)o1 |
| InChI | InChI=1S/C18H13F3N2O4S/c19-18(20,21)12-6-9-16(22-10-12)28(25,26)11-14-7-8-15(27-14)17(24)23-13-4-2-1-3-5-13/h1-10H,11H2,(H,23,24) |
| InChIKey | GCYCUDCFJHTABH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |