C19H14F3N3O6S — CID 29408962
5-(benzenesulfonylmethyl)-N'-[2-nitro-4-(trifluoromethyl)phenyl]furan-2-carbohydrazide (PubChem CID 29408962) has the molecular formula C19H14F3N3O6S and a molecular weight of 469.40 g/mol. Its IUPAC name is 5-(benzenesulfonylmethyl)-N'-[2-nitro-4-(trifluoromethyl)phenyl]furan-2-carbohydrazide.
| Compound Name | 5-(benzenesulfonylmethyl)-N'-[2-nitro-4-(trifluoromethyl)phenyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 29408962 |
| Molecular Formula | C19H14F3N3O6S |
| Molecular Weight | 469.40 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | 5-(benzenesulfonylmethyl)-N'-[2-nitro-4-(trifluoromethyl)phenyl]furan-2-carbohydrazide |
| SMILES | O=C(NNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])c1ccc(CS(=O)(=O)c2ccccc2)o1 |
| InChI | InChI=1S/C19H14F3N3O6S/c20-19(21,22)12-6-8-15(16(10-12)25(27)28)23-24-18(26)17-9-7-13(31-17)11-32(29,30)14-4-2-1-3-5-14/h1-10,23H,11H2,(H,24,26) |
| InChIKey | XTTVDCMXUFVNBN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|