C24H19N3O2S — CID 5060385
4-(1,2-dihydroacenaphthylen-5-ylmethylideneamino)-N-pyridin-2-ylbenzenesulfonamide (PubChem CID 5060385) has the molecular formula C24H19N3O2S and a molecular weight of 413.50 g/mol. Its IUPAC name is 4-(1,2-dihydroacenaphthylen-5-ylmethylideneamino)-N-pyridin-2-ylbenzenesulfonamide.
| Compound Name | 4-(1,2-dihydroacenaphthylen-5-ylmethylideneamino)-N-pyridin-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 5060385 |
| Molecular Formula | C24H19N3O2S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 4-(1,2-dihydroacenaphthylen-5-ylmethylideneamino)-N-pyridin-2-ylbenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccccn1)c1ccc(/N=C/c2ccc3c4c(cccc24)CC3)cc1 |
| InChI | InChI=1S/C24H19N3O2S/c28-30(29,27-23-6-1-2-15-25-23)21-13-11-20(12-14-21)26-16-19-10-9-18-8-7-17-4-3-5-22(19)24(17)18/h1-6,9-16H,7-8H2,(H,25,27)/b26-16+ |
| InChIKey | YSTAFYIDMIPTFL-WGOQTCKBSA-N |
| XLogP | 4.88 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|